C22H32IN3O3S — CID 111403278
1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide (PubChem CID 111403278) has the molecular formula C22H32IN3O3S and a molecular weight of 545.49 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111403278 |
| Molecular Formula | C22H32IN3O3S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC(C)c1ccccc1)NCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C22H31N3O3S.HI/c1-3-23-22(25-16-18-29(26,27)21-13-8-5-9-14-21)24-15-10-17-28-19(2)20-11-6-4-7-12-20;/h4-9,11-14,19H,3,10,15-18H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | PSUYTJOLXVKMMF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|