C19H33N3O3S — CID 111400905
2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine (PubChem CID 111400905) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine.
| Compound Name | 2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111400905 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCS(=O)(=O)c1ccccc1)NCCCOCC(C)C |
| InChI | InChI=1S/C19H33N3O3S/c1-4-20-19(21-12-8-14-25-16-17(2)3)22-13-9-15-26(23,24)18-10-6-5-7-11-18/h5-7,10-11,17H,4,8-9,12-16H2,1-3H3,(H2,20,21,22) |
| InChIKey | SDSCHCYQJBRTII-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|