C15H22IN3O2S — CID 136921756
2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 136921756) has the molecular formula C15H22IN3O2S and a molecular weight of 435.33 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136921756 |
| Molecular Formula | C15H22IN3O2S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CCCS(=O)(=O)c1ccccc1)NCC.I |
| InChI | InChI=1S/C15H21N3O2S.HI/c1-3-11-17-15(16-4-2)18-12-8-13-21(19,20)14-9-6-5-7-10-14;/h1,5-7,9-10H,4,8,11-13H2,2H3,(H2,16,17,18);1H |
| InChIKey | RSEITWBSZCQSCL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|