C21H30IN3O2S — CID 111342448
1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111342448) has the molecular formula C21H30IN3O2S and a molecular weight of 515.46 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111342448 |
| Molecular Formula | C21H30IN3O2S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccccc1)NCCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C21H29N3O2S.HI/c1-3-22-21(24-17-18(2)19-11-6-4-7-12-19)23-15-10-16-27(25,26)20-13-8-5-9-14-20;/h4-9,11-14,18H,3,10,15-17H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | PGIBLKDEVMJCDT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|