C17H24IN3O2S2 — CID 111939100
1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111939100) has the molecular formula C17H24IN3O2S2 and a molecular weight of 493.44 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111939100 |
| Molecular Formula | C17H24IN3O2S2 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C17H23N3O2S2.HI/c1-2-18-17(20-13-15-9-11-23-14-15)19-10-6-12-24(21,22)16-7-4-3-5-8-16;/h3-5,7-9,11,14H,2,6,10,12-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | UQHKYSRRAADNQC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|