C19H27N3OS — CID 111939903
1-ethyl-3-(4-phenylmethoxybutyl)-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 111939903) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 1-ethyl-3-(4-phenylmethoxybutyl)-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-(4-phenylmethoxybutyl)-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111939903 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-ethyl-3-(4-phenylmethoxybutyl)-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccsc1)NCCCCOCc1ccccc1 |
| InChI | InChI=1S/C19H27N3OS/c1-2-20-19(22-14-18-10-13-24-16-18)21-11-6-7-12-23-15-17-8-4-3-5-9-17/h3-5,8-10,13,16H,2,6-7,11-12,14-15H2,1H3,(H2,20,21,22) |
| InChIKey | OMIBPTVLEAKIIL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|