C18H23ClIN3O2S — CID 111131467
1-[2-(benzenesulfonyl)ethyl]-2-[(4-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111131467) has the molecular formula C18H23ClIN3O2S and a molecular weight of 507.83 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-[(4-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-[(4-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111131467 |
| Molecular Formula | C18H23ClIN3O2S |
| Molecular Weight | 507.83 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-[(4-chlorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)NCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C18H22ClN3O2S.HI/c1-2-20-18(22-14-15-8-10-16(19)11-9-15)21-12-13-25(23,24)17-6-4-3-5-7-17;/h3-11H,2,12-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | VSQFRAJPAZMOTL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|