C16H25ClN4O2S2 — CID 111833125
2-[(4-chlorophenyl)methyl]-1-ethyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111833125) has the molecular formula C16H25ClN4O2S2 and a molecular weight of 404.99 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-ethyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-ethyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111833125 |
| Molecular Formula | C16H25ClN4O2S2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-ethyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H25ClN4O2S2/c1-2-18-16(20-13-14-3-5-15(17)6-4-14)19-7-12-25(22,23)21-8-10-24-11-9-21/h3-6H,2,7-13H2,1H3,(H2,18,19,20) |
| InChIKey | OXRBMJLVXUNMNM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|