C16H26FIN4O2S2 — CID 111833378
1-ethyl-2-[(2-fluorophenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833378) has the molecular formula C16H26FIN4O2S2 and a molecular weight of 516.45 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833378 |
| Molecular Formula | C16H26FIN4O2S2 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCS(=O)(=O)N1CCSCC1.I |
| InChI | InChI=1S/C16H25FN4O2S2.HI/c1-2-18-16(20-13-14-5-3-4-6-15(14)17)19-7-12-25(22,23)21-8-10-24-11-9-21;/h3-6H,2,7-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | VKJFEORAACTRAP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|