C16H28N4O3S3 — CID 109418666
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 109418666) has the molecular formula C16H28N4O3S3 and a molecular weight of 420.63 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 109418666 |
| Molecular Formula | C16H28N4O3S3 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H28N4O3S3/c1-3-17-15(19-13-16(2,21)14-5-4-9-25-14)18-6-12-26(22,23)20-7-10-24-11-8-20/h4-5,9,21H,3,6-8,10-13H2,1-2H3,(H2,17,18,19) |
| InChIKey | UPRYTIUNSZVWHN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|