C16H30N4O3S2 — CID 109419846
1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109419846) has the molecular formula C16H30N4O3S2 and a molecular weight of 390.58 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109419846 |
| Molecular Formula | C16H30N4O3S2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C16H30N4O3S2/c1-5-17-15(18-10-8-11-20(6-2)25(4,22)23)19-13-16(3,21)14-9-7-12-24-14/h7,9,12,21H,5-6,8,10-11,13H2,1-4H3,(H2,17,18,19) |
| InChIKey | UKWDBXFVRZWDGX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|