C19H27N3O3S2 — CID 109420460
1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109420460) has the molecular formula C19H27N3O3S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109420460 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-3-20-18(22-15-19(2,23)17-11-7-13-26-17)21-12-8-14-27(24,25)16-9-5-4-6-10-16/h4-7,9-11,13,23H,3,8,12,14-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | QSGYMWJNJTUONP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|