C18H25FIN3O3S2 — CID 109420051
1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109420051) has the molecular formula C18H25FIN3O3S2 and a molecular weight of 541.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420051 |
| Molecular Formula | C18H25FIN3O3S2 |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCS(=O)(=O)c1ccccc1F.I |
| InChI | InChI=1S/C18H24FN3O3S2.HI/c1-3-20-17(22-13-18(2,23)16-9-6-11-26-16)21-10-12-27(24,25)15-8-5-4-7-14(15)19;/h4-9,11,23H,3,10,12-13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | DZFZCBDTVVJAPN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|