C18H23ClFN3OS — CID 109418642
1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109418642) has the molecular formula C18H23ClFN3OS and a molecular weight of 383.92 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109418642 |
| Molecular Formula | C18H23ClFN3OS |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H23ClFN3OS/c1-3-21-17(23-12-18(2,24)16-8-5-11-25-16)22-10-9-13-14(19)6-4-7-15(13)20/h4-8,11,24H,3,9-10,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | AKQZIPNMSSZVIN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|