C13H25IN4O2S2 — CID 111581471
1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111581471) has the molecular formula C13H25IN4O2S2 and a molecular weight of 460.41 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111581471 |
| Molecular Formula | C13H25IN4O2S2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)NCCS(N)(=O)=O.I |
| InChI | InChI=1S/C13H24N4O2S2.HI/c1-4-15-12(16-7-9-21(14,18)19)17-10-13(2,3)11-6-5-8-20-11;/h5-6,8H,4,7,9-10H2,1-3H3,(H2,14,18,19)(H2,15,16,17);1H |
| InChIKey | GTHYETPUYKJSGG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|