C18H32N4OS — CID 111581369
N-[2-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111581369) has the molecular formula C18H32N4OS and a molecular weight of 352.55 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111581369 |
| Molecular Formula | C18H32N4OS |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H32N4OS/c1-7-19-16(21-11-10-20-15(23)17(2,3)4)22-13-18(5,6)14-9-8-12-24-14/h8-9,12H,7,10-11,13H2,1-6H3,(H,20,23)(H2,19,21,22) |
| InChIKey | RLVBQUUOHPPBDY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|