C19H32N4OS — CID 111582266
N-cyclopentyl-3-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]propanamide (PubChem CID 111582266) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is N-cyclopentyl-3-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-cyclopentyl-3-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111582266 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-cyclopentyl-3-[[N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)NCCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H32N4OS/c1-4-20-18(22-14-19(2,3)16-10-7-13-25-16)21-12-11-17(24)23-15-8-5-6-9-15/h7,10,13,15H,4-6,8-9,11-12,14H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | RKLKAKFLHMHECT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|