C20H27FIN3OS — CID 109420301
1-ethyl-3-[[1-(2-fluorophenyl)cyclopropyl]methyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109420301) has the molecular formula C20H27FIN3OS and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2-fluorophenyl)cyclopropyl]methyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[1-(2-fluorophenyl)cyclopropyl]methyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420301 |
| Molecular Formula | C20H27FIN3OS |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 1-ethyl-3-[[1-(2-fluorophenyl)cyclopropyl]methyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC1(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C20H26FN3OS.HI/c1-3-22-18(23-13-19(2,25)17-9-6-12-26-17)24-14-20(10-11-20)15-7-4-5-8-16(15)21;/h4-9,12,25H,3,10-11,13-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | KMXRBKQVIBXMGO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|