C16H27F3N4OS — CID 109418796
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 109418796) has the molecular formula C16H27F3N4OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 109418796 |
| Molecular Formula | C16H27F3N4OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C16H27F3N4OS/c1-4-20-14(21-8-6-9-23(3)12-16(17,18)19)22-11-15(2,24)13-7-5-10-25-13/h5,7,10,24H,4,6,8-9,11-12H2,1-3H3,(H2,20,21,22) |
| InChIKey | QFMJJCYUIMXVIE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|