C18H31N5O2S — CID 109420474
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109420474) has the molecular formula C18H31N5O2S and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109420474 |
| Molecular Formula | C18H31N5O2S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H31N5O2S/c1-4-19-17(21-14-18(3,25)16-6-5-13-26-16)20-7-8-22-9-11-23(12-10-22)15(2)24/h5-6,13,25H,4,7-12,14H2,1-3H3,(H2,19,20,21) |
| InChIKey | ZLSQLCPZEVUTQU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|