C20H36N4OS — CID 109420466
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methylpiperidin-1-yl)butyl]guanidine (PubChem CID 109420466) has the molecular formula C20H36N4OS and a molecular weight of 380.60 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methylpiperidin-1-yl)butyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methylpiperidin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 109420466 |
| Molecular Formula | C20H36N4OS |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methylpiperidin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCCN1CCCCC1C |
| InChI | InChI=1S/C20H36N4OS/c1-4-21-19(23-16-20(3,25)18-11-9-15-26-18)22-12-6-8-14-24-13-7-5-10-17(24)2/h9,11,15,17,25H,4-8,10,12-14,16H2,1-3H3,(H2,21,22,23) |
| InChIKey | JRNFCPVCSMFYAJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|