C18H31N5OS — CID 111581760
1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine (PubChem CID 111581760) has the molecular formula C18H31N5OS and a molecular weight of 365.55 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111581760 |
| Molecular Formula | C18H31N5OS |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCN1CCN(C(C)=O)CC1)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C18H31N5OS/c1-15(24)23-11-9-22(10-12-23)8-7-20-17(19-4)21-14-18(2,3)16-6-5-13-25-16/h5-6,13H,7-12,14H2,1-4H3,(H2,19,20,21) |
| InChIKey | CMEJHLMEGXYDRH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|