C18H31N3O2S — CID 111582004
methyl 7-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]heptanoate (PubChem CID 111582004) has the molecular formula C18H31N3O2S and a molecular weight of 353.53 g/mol. Its IUPAC name is methyl 7-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]heptanoate.
| Compound Name | methyl 7-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111582004 |
| Molecular Formula | C18H31N3O2S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | methyl 7-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]heptanoate |
| SMILES | C/N=C(\NCCCCCCC(=O)OC)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C18H31N3O2S/c1-18(2,15-10-9-13-24-15)14-21-17(19-3)20-12-8-6-5-7-11-16(22)23-4/h9-10,13H,5-8,11-12,14H2,1-4H3,(H2,19,20,21) |
| InChIKey | QOFSCRNWOAICMS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|