C17H32IN3OS — CID 111582716
1-(3-butoxypropyl)-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111582716) has the molecular formula C17H32IN3OS and a molecular weight of 453.43 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111582716 |
| Molecular Formula | C17H32IN3OS |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-(3-butoxypropyl)-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\C)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C17H31N3OS.HI/c1-5-6-11-21-12-8-10-19-16(18-4)20-14-17(2,3)15-9-7-13-22-15;/h7,9,13H,5-6,8,10-12,14H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | VRRJTXLGJIJFMX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|