C20H31ClFN5O — CID 111569189
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methylguanidine (PubChem CID 111569189) has the molecular formula C20H31ClFN5O and a molecular weight of 411.95 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111569189 |
| Molecular Formula | C20H31ClFN5O |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1CCN(C(C)=O)CC1)NCC(C)(C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H31ClFN5O/c1-15(28)27-11-9-26(10-12-27)8-7-24-19(23-4)25-14-20(2,3)17-6-5-16(22)13-18(17)21/h5-6,13H,7-12,14H2,1-4H3,(H2,23,24,25) |
| InChIKey | FGPYPJSRDJGJLW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|