C19H28ClFIN5 — CID 111569252
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111569252) has the molecular formula C19H28ClFIN5 and a molecular weight of 507.82 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111569252 |
| Molecular Formula | C19H28ClFIN5 |
| Molecular Weight | 507.82 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1cnn(C)c1)NCC(C)(C)c1ccc(F)cc1Cl.I |
| InChI | InChI=1S/C19H27ClFN5.HI/c1-19(2,16-8-7-15(21)10-17(16)20)13-24-18(22-3)23-9-5-6-14-11-25-26(4)12-14;/h7-8,10-12H,5-6,9,13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | HDLIYYMCNCOQRL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|