C20H29ClFN5 — CID 111569285
2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111569285) has the molecular formula C20H29ClFN5 and a molecular weight of 393.94 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111569285 |
| Molecular Formula | C20H29ClFN5 |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(F)cc1Cl)NCCCc1cnn(C)c1 |
| InChI | InChI=1S/C20H29ClFN5/c1-5-23-19(24-10-6-7-15-12-26-27(4)13-15)25-14-20(2,3)17-9-8-16(22)11-18(17)21/h8-9,11-13H,5-7,10,14H2,1-4H3,(H2,23,24,25) |
| InChIKey | XXOVWXCSFZVKIY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|