C18H25ClFN5O — CID 111569209
2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 111569209) has the molecular formula C18H25ClFN5O and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111569209 |
| Molecular Formula | C18H25ClFN5O |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(F)cc1Cl)NCCc1nc(C)no1 |
| InChI | InChI=1S/C18H25ClFN5O/c1-5-21-17(22-9-8-16-24-12(2)25-26-16)23-11-18(3,4)14-7-6-13(20)10-15(14)19/h6-7,10H,5,8-9,11H2,1-4H3,(H2,21,22,23) |
| InChIKey | INKUFTJNVAIPAF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|