C15H20FN5O — CID 111395445
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine (PubChem CID 111395445) has the molecular formula C15H20FN5O and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111395445 |
| Molecular Formula | C15H20FN5O |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FN5O/c1-3-17-15(19-10-14-20-11(2)21-22-14)18-8-7-12-5-4-6-13(16)9-12/h4-6,9H,3,7-8,10H2,1-2H3,(H2,17,18,19) |
| InChIKey | CLXQNEANBAOYGQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|