C17H23ClFN5 — CID 111569257
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111569257) has the molecular formula C17H23ClFN5 and a molecular weight of 351.86 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111569257 |
| Molecular Formula | C17H23ClFN5 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccnn1C)NCC(C)(C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H23ClFN5/c1-17(2,14-6-5-12(19)9-15(14)18)11-22-16(20-3)21-10-13-7-8-23-24(13)4/h5-9H,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | NZWCMBNLELDDBT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|