C17H24Cl2IN5 — CID 111955128
1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111955128) has the molecular formula C17H24Cl2IN5 and a molecular weight of 496.22 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111955128 |
| Molecular Formula | C17H24Cl2IN5 |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnn1C)NCC(C)(C)c1c(Cl)cccc1Cl.I |
| InChI | InChI=1S/C17H23Cl2N5.HI/c1-17(2,15-13(18)6-5-7-14(15)19)11-22-16(20-3)21-10-12-8-9-23-24(12)4;/h5-9H,10-11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | ZRXAAXPRVCMTBG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|