C18H23Cl2IN4 — CID 110970738
1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110970738) has the molecular formula C18H23Cl2IN4 and a molecular weight of 493.22 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110970738 |
| Molecular Formula | C18H23Cl2IN4 |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccn1)NCC(C)(C)c1c(Cl)cccc1Cl.I |
| InChI | InChI=1S/C18H22Cl2N4.HI/c1-18(2,16-14(19)8-6-9-15(16)20)12-24-17(21-3)23-11-13-7-4-5-10-22-13;/h4-10H,11-12H2,1-3H3,(H2,21,23,24);1H |
| InChIKey | YJCGLWWFEBWRHX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|