C18H22ClFN4 — CID 111569107
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 111569107) has the molecular formula C18H22ClFN4 and a molecular weight of 348.85 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111569107 |
| Molecular Formula | C18H22ClFN4 |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccccn1)NCC(C)(C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H22ClFN4/c1-18(2,15-8-7-13(20)10-16(15)19)12-24-17(21-3)23-11-14-6-4-5-9-22-14/h4-10H,11-12H2,1-3H3,(H2,21,23,24) |
| InChIKey | ZYVZBGRYEDEESH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|