C8H13N5 — CID 116510700
1-amino-2-methyl-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 116510700) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 1-amino-2-methyl-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-amino-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 116510700 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 1-amino-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NN)NCc1ccccn1 |
| InChI | InChI=1S/C8H13N5/c1-10-8(13-9)12-6-7-4-2-3-5-11-7/h2-5H,6,9H2,1H3,(H2,10,12,13) |
| InChIKey | LSILRHYQQSFCAB-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|