C8H14N6 — CID 116510819
1-amino-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine (PubChem CID 116510819) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-amino-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine.
| Compound Name | 1-amino-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 116510819 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-amino-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NN)NCc1ccnc(C)n1 |
| InChI | InChI=1S/C8H14N6/c1-6-11-4-3-7(13-6)5-12-8(10-2)14-9/h3-4H,5,9H2,1-2H3,(H2,10,12,14) |
| InChIKey | ZRSZODNYSBNILU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|