C18H29N5 — CID 119134140
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine (PubChem CID 119134140) has the molecular formula C18H29N5 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119134140 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccnc(C)n1)NC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H29N5/c1-13-20-10-9-17(22-13)12-21-18(19-2)23-16-8-7-14-5-3-4-6-15(14)11-16/h9-10,14-16H,3-8,11-12H2,1-2H3,(H2,19,21,23) |
| InChIKey | ULNDILQSXQGFKS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|