C12H20IN5 — CID 119151764
2-methyl-1-(2-methylcyclopropyl)-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119151764) has the molecular formula C12H20IN5 and a molecular weight of 361.23 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclopropyl)-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylcyclopropyl)-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151764 |
| Molecular Formula | C12H20IN5 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-methyl-1-(2-methylcyclopropyl)-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc(C)n1)NC1CC1C.I |
| InChI | InChI=1S/C12H19N5.HI/c1-8-6-11(8)17-12(13-3)15-7-10-4-5-14-9(2)16-10;/h4-5,8,11H,6-7H2,1-3H3,(H2,13,15,17);1H |
| InChIKey | WJTHFXOEICVDBU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|