C12H17N5S — CID 111962171
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-(2-methylcyclopropyl)guanidine (PubChem CID 111962171) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111962171 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-(2-methylcyclopropyl)guanidine |
| SMILES | C/N=C(\NCc1cn2ccsc2n1)NC1CC1C |
| InChI | InChI=1S/C12H17N5S/c1-8-5-10(8)16-11(13-2)14-6-9-7-17-3-4-18-12(17)15-9/h3-4,7-8,10H,5-6H2,1-2H3,(H2,13,14,16) |
| InChIKey | VPXPRBZNHNDMFY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|