C16H18FN5S — CID 111845551
1-[(3-fluoro-4-methylphenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine (PubChem CID 111845551) has the molecular formula C16H18FN5S and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111845551 |
| Molecular Formula | C16H18FN5S |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(C)c(F)c1)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C16H18FN5S/c1-11-3-4-12(7-14(11)17)8-19-15(18-2)20-9-13-10-22-5-6-23-16(22)21-13/h3-7,10H,8-9H2,1-2H3,(H2,18,19,20) |
| InChIKey | JMNMHALBPOEHMI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|