C19H23IN6OS — CID 111412843
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111412843) has the molecular formula C19H23IN6OS and a molecular weight of 510.41 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111412843 |
| Molecular Formula | C19H23IN6OS |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCCC2=O)cc1)NCc1cn2ccsc2n1.I |
| InChI | InChI=1S/C19H22N6OS.HI/c1-20-18(22-12-15-13-24-9-10-27-19(24)23-15)21-11-14-4-6-16(7-5-14)25-8-2-3-17(25)26;/h4-7,9-10,13H,2-3,8,11-12H2,1H3,(H2,20,21,22);1H |
| InChIKey | HITNGJHSIKSUMY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|