C21H29IN6O — CID 109403367
1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109403367) has the molecular formula C21H29IN6O and a molecular weight of 508.41 g/mol. Its IUPAC name is 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109403367 |
| Molecular Formula | C21H29IN6O |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCCC2=O)cc1)NCc1cccc(N(C)C)n1.I |
| InChI | InChI=1S/C21H28N6O.HI/c1-22-21(24-15-17-6-4-7-19(25-17)26(2)3)23-14-16-9-11-18(12-10-16)27-13-5-8-20(27)28;/h4,6-7,9-12H,5,8,13-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | DDPHJKUNCHYHET-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|