C16H20IN5OS — CID 111249562
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111249562) has the molecular formula C16H20IN5OS and a molecular weight of 457.34 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111249562 |
| Molecular Formula | C16H20IN5OS |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OC)c1)NCc1cn2ccsc2n1.I |
| InChI | InChI=1S/C16H19N5OS.HI/c1-17-15(18-9-12-4-3-5-14(8-12)22-2)19-10-13-11-21-6-7-23-16(21)20-13;/h3-8,11H,9-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | KJBBCYCBJSZXPQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|