C16H17F3IN5OS — CID 111847776
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111847776) has the molecular formula C16H17F3IN5OS and a molecular weight of 511.31 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111847776 |
| Molecular Formula | C16H17F3IN5OS |
| Molecular Weight | 511.31 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2ccsc2n1)NCc1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C16H16F3N5OS.HI/c1-20-14(22-9-12-10-24-6-7-26-15(24)23-12)21-8-11-4-2-3-5-13(11)25-16(17,18)19;/h2-7,10H,8-9H2,1H3,(H2,20,21,22);1H |
| InChIKey | JGVFODZRTSHSSU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|