C16H23F3IN3O3 — CID 111848234
methyl 5-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 111848234) has the molecular formula C16H23F3IN3O3 and a molecular weight of 489.28 g/mol. Its IUPAC name is methyl 5-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111848234 |
| Molecular Formula | C16H23F3IN3O3 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | methyl 5-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCC(=O)OC)NCc1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C16H22F3N3O3.HI/c1-20-15(21-10-6-5-9-14(23)24-2)22-11-12-7-3-4-8-13(12)25-16(17,18)19;/h3-4,7-8H,5-6,9-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | RMPRBHZWHOYEKO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|