C19H25F3IN5O — CID 111848516
2-methyl-1-[4-(pyridin-2-ylamino)butyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111848516) has the molecular formula C19H25F3IN5O and a molecular weight of 523.34 g/mol. Its IUPAC name is 2-methyl-1-[4-(pyridin-2-ylamino)butyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[4-(pyridin-2-ylamino)butyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111848516 |
| Molecular Formula | C19H25F3IN5O |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 2-methyl-1-[4-(pyridin-2-ylamino)butyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCNc1ccccn1)NCc1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C19H24F3N5O.HI/c1-23-18(26-13-7-6-12-25-17-10-4-5-11-24-17)27-14-15-8-2-3-9-16(15)28-19(20,21)22;/h2-5,8-11H,6-7,12-14H2,1H3,(H,24,25)(H2,23,26,27);1H |
| InChIKey | JDLDOPHHQOGPSY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|