C15H27N5 — CID 110966440
1-tert-butyl-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 110966440) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 1-tert-butyl-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-tert-butyl-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 110966440 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 1-tert-butyl-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | C/N=C(/NCCCCNc1ccccn1)NC(C)(C)C |
| InChI | InChI=1S/C15H27N5/c1-15(2,3)20-14(16-4)19-12-8-7-11-18-13-9-5-6-10-17-13/h5-6,9-10H,7-8,11-12H2,1-4H3,(H,17,18)(H2,16,19,20) |
| InChIKey | NYKCLMSREUNCQZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|