C11H16N6 — CID 90667253
1-cyano-2-methyl-3-[3-(pyridin-2-ylamino)propyl]guanidine (PubChem CID 90667253) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[3-(pyridin-2-ylamino)propyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[3-(pyridin-2-ylamino)propyl]guanidine |
|---|---|
| PubChem CID | 90667253 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 1-cyano-2-methyl-3-[3-(pyridin-2-ylamino)propyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCNc1ccccn1 |
| InChI | InChI=1S/C11H16N6/c1-13-11(17-9-12)16-8-4-7-15-10-5-2-3-6-14-10/h2-3,5-6H,4,7-8H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | FOIPOBUIXCOHPE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|