C17H32IN5O — CID 111945806
1-(4-ethoxybutyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111945806) has the molecular formula C17H32IN5O and a molecular weight of 449.38 g/mol. Its IUPAC name is 1-(4-ethoxybutyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-(4-ethoxybutyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111945806 |
| Molecular Formula | C17H32IN5O |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-(4-ethoxybutyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCOCCCCN/C(=N\C)NCCCCNc1ccccn1.I |
| InChI | InChI=1S/C17H31N5O.HI/c1-3-23-15-9-8-14-22-17(18-2)21-13-7-6-12-20-16-10-4-5-11-19-16;/h4-5,10-11H,3,6-9,12-15H2,1-2H3,(H,19,20)(H2,18,21,22);1H |
| InChIKey | KBZBMVNELOXAAF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|