C20H36N6 — CID 111387193
2-methyl-1-[3-(4-methylpiperidin-1-yl)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111387193) has the molecular formula C20H36N6 and a molecular weight of 360.55 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-methylpiperidin-1-yl)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 2-methyl-1-[3-(4-methylpiperidin-1-yl)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111387193 |
| Molecular Formula | C20H36N6 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 2-methyl-1-[3-(4-methylpiperidin-1-yl)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | C/N=C(\NCCCCNc1ccccn1)NCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C20H36N6/c1-18-9-16-26(17-10-18)15-7-14-25-20(21-2)24-13-6-5-12-23-19-8-3-4-11-22-19/h3-4,8,11,18H,5-7,9-10,12-17H2,1-2H3,(H,22,23)(H2,21,24,25) |
| InChIKey | ZOZOUCAEDKMLTA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|