C23H36N6 — CID 111851168
2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111851168) has the molecular formula C23H36N6 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111851168 |
| Molecular Formula | C23H36N6 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCCN1CCC(C)CC1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C23H36N6/c1-20-10-16-28(17-11-20)14-6-5-12-25-23(24-2)26-18-21-8-3-4-9-22(21)19-29-15-7-13-27-29/h3-4,7-9,13,15,20H,5-6,10-12,14,16-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | NOGYAKDXSHRUIP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|